CAS 67233-85-6 appears in our catalog under these names: 5-Nitroguaiacol sodium salt, 98%, 5-Nitroguaiacol sodium, Sodium 5-Nitroguaiacolate, >95% (HPLC), 5–Nitroguaiacol (sodium), 5-Nitroguaiacol Sodium Salt, >98.0%(T). Offered by: Combi-blocks, Dr. Ehrenstorfer, TRC, GLPBio, TCI. Available pack sizes: 25g, 5g, 100g, 1g, 100mg, 2,5g, 250mg, 500mg.
Sodium 2-methoxy-5-nitrophenolate (CAS 67233-85-6) is a chemical compound with the molecular formula C7H6NNaO4 and a molecular weight of 191.12 g/mol. IUPAC name: sodium 2-methoxy-5-nitrophenolate. InChIKey: KBRKFTKQRMYINW-UHFFFAOYSA-M.
| Molecular formula | C7H6NNaO4 |
|---|---|
| Molecular weight | 191.12 g/mol |
| IUPAC name | sodium 2-methoxy-5-nitrophenolate |
| InChIKey | KBRKFTKQRMYINW-UHFFFAOYSA-M |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])[O-].[Na+] |
Computed by PubChem (NCBI)