Products 67244-90-0
CAS 67244-90-0 is the registry number for Phenylpropanolamine bitartrate. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
(1S,2R)-2-amino-1-phenylpropan-1-ol;(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 67244-90-0) is a chemical compound with the molecular formula C13H19NO7 and a molecular weight of 301.29 g/mol. IUPAC name: (1S,2R)-2-amino-1-phenylpropan-1-ol;(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: NCHHVLCKEUNWNJ-HHJRAVAGSA-N.
| Molecular formula | C13H19NO7 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (1S,2R)-2-amino-1-phenylpropan-1-ol;(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | NCHHVLCKEUNWNJ-HHJRAVAGSA-N |
| SMILES | C[C@H]([C@H](C1=CC=CC=C1)O)N.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)