CAS 67287-54-1 is the registry number for Fenoldopam Hydrobromide. Offered by: TRC. Available pack sizes: 10mg, 1mg, 25mg.
9-chloro-5-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide (CAS 67287-54-1) is a chemical compound with the molecular formula C16H17BrClNO3 and a molecular weight of 386.7 g/mol. IUPAC name: 9-chloro-5-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide. InChIKey: DSGOSRLTVBPLCU-UHFFFAOYSA-N.
| Molecular formula | C16H17BrClNO3 |
|---|---|
| Molecular weight | 386.7 g/mol |
| IUPAC name | 9-chloro-5-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide |
| InChIKey | DSGOSRLTVBPLCU-UHFFFAOYSA-N |
| SMILES | C1CNCC(C2=CC(=C(C(=C21)Cl)O)O)C3=CC=C(C=C3)O.Br |
Computed by PubChem (NCBI)