CAS 6729-60-8 appears in our catalog under these names: Tri-o-tolylbismuth dichloride, 95%, Tri–o–tolylbismuth Dichloride, Tri-o-tolylbismuth Dichloride, >97.0%(T). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 250mg, 5g, 1g, 200mg.
Dichloro-tris(2-methylphenyl)bismuth (CAS 6729-60-8) is a chemical compound with the molecular formula C21H21BiCl2 and a molecular weight of 553.3 g/mol. IUPAC name: dichloro-tris(2-methylphenyl)bismuth. InChIKey: RLWWKAGRZATJDC-UHFFFAOYSA-L.
| Molecular formula | C21H21BiCl2 |
|---|---|
| Molecular weight | 553.3 g/mol |
| IUPAC name | dichloro-tris(2-methylphenyl)bismuth |
| InChIKey | RLWWKAGRZATJDC-UHFFFAOYSA-L |
| SMILES | CC1=CC=CC=C1[Bi](C2=CC=CC=C2C)(C3=CC=CC=C3C)(Cl)Cl |
Computed by PubChem (NCBI)