CAS 672925-36-9 is the registry number for N'-(4-Fluorobenzoyl)-3-(1H-pyrrol-1-yl)-2-thiophenecarbohydrazide. Offered by: TRC. Available pack sizes: 100mg.
N'-(4-fluorobenzoyl)-3-pyrrol-1-ylthiophene-2-carbohydrazide (CAS 672925-36-9) is a chemical compound with the molecular formula C16H12FN3O2S and a molecular weight of 329.4 g/mol. IUPAC name: N'-(4-fluorobenzoyl)-3-pyrrol-1-ylthiophene-2-carbohydrazide. InChIKey: OUZKYHWZWDOLRB-UHFFFAOYSA-N.
| Molecular formula | C16H12FN3O2S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | N'-(4-fluorobenzoyl)-3-pyrrol-1-ylthiophene-2-carbohydrazide |
| InChIKey | OUZKYHWZWDOLRB-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=C(SC=C2)C(=O)NNC(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)