Products 672946-08-6

CAS 672946-08-6 is the registry number for 2-Nitro-5-(2,4,6-trifluorophenoxy)pyridine 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-nitro-5-(2,4,6-trifluorophenoxy)pyridine (CAS 672946-08-6) is a chemical compound with the molecular formula C11H5F3N2O3 and a molecular weight of 270.16 g/mol. IUPAC name: 2-nitro-5-(2,4,6-trifluorophenoxy)pyridine. InChIKey: QKDDTXHVSBPDBE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H5F3N2O3
Molecular weight270.16 g/mol
IUPAC name2-nitro-5-(2,4,6-trifluorophenoxy)pyridine
InChIKeyQKDDTXHVSBPDBE-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1OC2=C(C=C(C=C2F)F)F)[N+](=O)[O-]

Computed by PubChem (NCBI)