CAS 67335-10-8 is the registry number for 8-Bromo-7-methoxyisoquinoline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
8-bromo-7-methoxyisoquinoline (CAS 67335-10-8) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 8-bromo-7-methoxyisoquinoline. InChIKey: UQRCCDNGYVDNCR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 8-bromo-7-methoxyisoquinoline |
| InChIKey | UQRCCDNGYVDNCR-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=CN=C2)Br |
Computed by PubChem (NCBI)