Products 67336-99-6
CAS 67336-99-6 appears in our catalog under these names: Z-Gly-Pro-βNA, Z–Gly–Pro–βNA, Z-Gly-Pro-bNA. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 1g, 5g, 1000mg, 2000mg, 5000mg.
Benzyl N-[2-[(2S)-2-(naphthalen-2-ylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate (CAS 67336-99-6) is a chemical compound with the molecular formula C25H25N3O4 and a molecular weight of 431.5 g/mol. IUPAC name: benzyl N-[2-[(2S)-2-(naphthalen-2-ylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate. InChIKey: YVMWGYRWDXZYLQ-QFIPXVFZSA-N.
| Molecular formula | C25H25N3O4 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | benzyl N-[2-[(2S)-2-(naphthalen-2-ylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| InChIKey | YVMWGYRWDXZYLQ-QFIPXVFZSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)CNC(=O)OCC2=CC=CC=C2)C(=O)NC3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)