CAS 67392-96-5 is the registry number for Sitosterone. Offered by: MedChemExpress. Available pack sizes: Get quote.
Beta-sitostenone is a C29-steroid and a steroid. It has a role as a metabolite. It derives from a hydride of a stigmastane.
Source: ChEBI
| Molecular formula | C29H48O |
|---|---|
| Molecular weight | 412.7 g/mol |
| IUPAC name | (8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | RUVUHIUYGJBLGI-XJZKHKOHSA-N |
| SMILES | CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)C(C)C |
Computed by PubChem (NCBI)