CAS 674335-88-7 is the registry number for Methyl 4,4,4-trifluoro-3-(trifluoromethyl)butanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4,4,4-trifluoro-3-(trifluoromethyl)butanoate (CAS 674335-88-7) is a chemical compound with the molecular formula C6H6F6O2 and a molecular weight of 224.10 g/mol. IUPAC name: methyl 4,4,4-trifluoro-3-(trifluoromethyl)butanoate. InChIKey: OJEPGAFAXRZUFN-UHFFFAOYSA-N.
| Molecular formula | C6H6F6O2 |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | methyl 4,4,4-trifluoro-3-(trifluoromethyl)butanoate |
| InChIKey | OJEPGAFAXRZUFN-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)