CAS 67442-91-5 is the registry number for 1-Mercapto-4-(m-tolyl)-[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-methylphenyl)-1-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]quinazolin-5-one (CAS 67442-91-5) is a chemical compound with the molecular formula C16H12N4OS and a molecular weight of 308.4 g/mol. IUPAC name: 4-(3-methylphenyl)-1-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]quinazolin-5-one. InChIKey: GIOHZUXLYXFUQU-UHFFFAOYSA-N.
| Molecular formula | C16H12N4OS |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 4-(3-methylphenyl)-1-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| InChIKey | GIOHZUXLYXFUQU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=O)C3=CC=CC=C3N4C2=NNC4=S |
Computed by PubChem (NCBI)