Products 6745-43-3
CAS 6745-43-3 appears in our catalog under these names: Imidazole-d3, >95% (HPLC), Imidazole-d3. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 250mg.
2,4,5-trideuterio-1H-imidazole (CAS 6745-43-3) is a chemical compound with the molecular formula C3H4N2 and a molecular weight of 71.10 g/mol. IUPAC name: 2,4,5-trideuterio-1H-imidazole. InChIKey: RAXXELZNTBOGNW-CBYSEHNBSA-N.
| Molecular formula | C3H4N2 |
|---|---|
| Molecular weight | 71.10 g/mol |
| IUPAC name | 2,4,5-trideuterio-1H-imidazole |
| InChIKey | RAXXELZNTBOGNW-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(N=C(N1)[2H])[2H] |
Computed by PubChem (NCBI)