Products 67450-45-7
CAS 67450-45-7 appears in our catalog under these names: Eclanamine maleate, U–48753E (maleate), Eclanamine (maleate). Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
(Z)-but-2-enedioic acid;N-(3,4-dichlorophenyl)-N-[(1R,2R)-2-(dimethylamino)cyclopentyl]propanamide (CAS 67450-45-7) is a chemical compound with the molecular formula C20H26Cl2N2O5 and a molecular weight of 445.3 g/mol. IUPAC name: (Z)-but-2-enedioic acid;N-(3,4-dichlorophenyl)-N-[(1R,2R)-2-(dimethylamino)cyclopentyl]propanamide. InChIKey: ZEUQHGFLDLNEOB-CHHFXETESA-N.
| Molecular formula | C20H26Cl2N2O5 |
|---|---|
| Molecular weight | 445.3 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;N-(3,4-dichlorophenyl)-N-[(1R,2R)-2-(dimethylamino)cyclopentyl]propanamide |
| InChIKey | ZEUQHGFLDLNEOB-CHHFXETESA-N |
| SMILES | CCC(=O)N([C@@H]1CCC[C@H]1N(C)C)C2=CC(=C(C=C2)Cl)Cl.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)