CAS 67469-75-4 appears in our catalog under these names: GBR 12783 Dihydrochloride, GBR 12783 dihydrochloride/ 97.81% (existing batch purity), GBR 12783 dihydrochloride, 1-(2-(Benzhydryloxy)ethyl)-4-cinnamylpiperazine dihydrochloride, 95%, 95%, GBR 12783 (dihydrochloride), 99.14%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1mg, 2,5mg, 5mg, 2mg, 10mg, 25mg, 50mg, 100mg.
1-(2-benzhydryloxyethyl)-4-[(E)-3-phenylprop-2-enyl]piperazine;dihydrochloride (CAS 67469-75-4) is a chemical compound with the molecular formula C28H34Cl2N2O and a molecular weight of 485.5 g/mol. IUPAC name: 1-(2-benzhydryloxyethyl)-4-[(E)-3-phenylprop-2-enyl]piperazine;dihydrochloride. InChIKey: HJDXBLLTRMCYNC-JFXLULTRSA-N.
| Molecular formula | C28H34Cl2N2O |
|---|---|
| Molecular weight | 485.5 g/mol |
| IUPAC name | 1-(2-benzhydryloxyethyl)-4-[(E)-3-phenylprop-2-enyl]piperazine;dihydrochloride |
| InChIKey | HJDXBLLTRMCYNC-JFXLULTRSA-N |
| SMILES | C1CN(CCN1CCOC(C2=CC=CC=C2)C3=CC=CC=C3)C/C=C/C4=CC=CC=C4.Cl.Cl |
Computed by PubChem (NCBI)