CAS 674768-11-7 is the registry number for (1R,4R)-N-Formyl-N-desmethyl Sertraline. Offered by: TRC. Available pack sizes: 50mg.
N-[(1R,4R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]formamide (CAS 674768-11-7) is a chemical compound with the molecular formula C17H15Cl2NO and a molecular weight of 320.2 g/mol. IUPAC name: N-[(1R,4R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]formamide. InChIKey: QTQHFJQQMCUQEY-SJKOYZFVSA-N.
| Molecular formula | C17H15Cl2NO |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | N-[(1R,4R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]formamide |
| InChIKey | QTQHFJQQMCUQEY-SJKOYZFVSA-N |
| SMILES | C1C[C@H](C2=CC=CC=C2[C@H]1C3=CC(=C(C=C3)Cl)Cl)NC=O |
Computed by PubChem (NCBI)