CAS 67478-47-1 is the registry number for 2-Bromo-1-trityl-1H-imidazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-bromo-1-tritylimidazole (CAS 67478-47-1) is a chemical compound with the molecular formula C22H17BrN2 and a molecular weight of 389.3 g/mol. IUPAC name: 2-bromo-1-tritylimidazole. InChIKey: CSRUMYQPYPNDPR-UHFFFAOYSA-N.
| Molecular formula | C22H17BrN2 |
|---|---|
| Molecular weight | 389.3 g/mol |
| IUPAC name | 2-bromo-1-tritylimidazole |
| InChIKey | CSRUMYQPYPNDPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=CN=C4Br |
Computed by PubChem (NCBI)