Products 67485-29-4
CAS 67485-29-4 appears in our catalog under these names: Hydramethylnon, min. 95 %, 250 mg, Hydramethylon, >95% (HPLC), Hydramethylnon, Hydramethylnon/ 100%, Hydramethylnon, min. 95 %, 500 mg. Offered by: Roth, TRC, Dr. Ehrenstorfer, TargetMol, Chemat. Available pack sizes: 250mg, 10g, 1g, 100mg, 5mg, 10mg, 25mg, 50mg.
N-[1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylideneamino]-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine (CAS 67485-29-4) is a chemical compound with the molecular formula C25H24F6N4 and a molecular weight of 494.5 g/mol. IUPAC name: N-[1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylideneamino]-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine. InChIKey: IQVNEKKDSLOHHK-UHFFFAOYSA-N.
| Molecular formula | C25H24F6N4 |
|---|---|
| Molecular weight | 494.5 g/mol |
| IUPAC name | N-[1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylideneamino]-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine |
| InChIKey | IQVNEKKDSLOHHK-UHFFFAOYSA-N |
| SMILES | CC1(CNC(=NC1)NN=C(C=CC2=CC=C(C=C2)C(F)(F)F)C=CC3=CC=C(C=C3)C(F)(F)F)C |
Computed by PubChem (NCBI)
Synonyms:
hydromethylnon, Amdro, Combat, Hydramethylnon, Maxforce, Wipeout, IQVNEKKDSLOHHK-UHFFFAOYSA-N