Products 675109-26-9
CAS 675109-26-9 appears in our catalog under these names: 6-Bromoisoindolin-1-one 97%, 6-Bromoisoindolin-1-One, 97%, 97%, 6-Bromoisoindolin-1-one, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g, 250mg.
6-bromo-2,3-dihydroisoindol-1-one (CAS 675109-26-9) is a chemical compound with the molecular formula C8H6BrNO and a molecular weight of 212.04 g/mol. IUPAC name: 6-bromo-2,3-dihydroisoindol-1-one. InChIKey: HYTCKZQYVIURAW-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO |
|---|---|
| Molecular weight | 212.04 g/mol |
| IUPAC name | 6-bromo-2,3-dihydroisoindol-1-one |
| InChIKey | HYTCKZQYVIURAW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)Br)C(=O)N1 |
Computed by PubChem (NCBI)