CAS 675590-26-8 is the registry number for 3–Bromo–5–(3–chlorophenyl)pyridine. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
3-bromo-5-(3-chlorophenyl)pyridine (CAS 675590-26-8) is a chemical compound with the molecular formula C11H7BrClN and a molecular weight of 268.53 g/mol. IUPAC name: 3-bromo-5-(3-chlorophenyl)pyridine. InChIKey: YEFLJKWCTTZYOE-UHFFFAOYSA-N.
| Molecular formula | C11H7BrClN |
|---|---|
| Molecular weight | 268.53 g/mol |
| IUPAC name | 3-bromo-5-(3-chlorophenyl)pyridine |
| InChIKey | YEFLJKWCTTZYOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)