Products 67560-68-3
CAS 67560-68-3 is the registry number for Lariciresinol dimethyl ether. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
[(2S,3R,4R)-2-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methanol (CAS 67560-68-3) is a chemical compound with the molecular formula C22H28O6 and a molecular weight of 388.5 g/mol. IUPAC name: [(2S,3R,4R)-2-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methanol. InChIKey: AYWPHVUFQNWITL-PNLZDCPESA-N.
| Molecular formula | C22H28O6 |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | [(2S,3R,4R)-2-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methanol |
| InChIKey | AYWPHVUFQNWITL-PNLZDCPESA-N |
| SMILES | COC1=C(C=C(C=C1)C[C@H]2CO[C@@H]([C@H]2CO)C3=CC(=C(C=C3)OC)OC)OC |
Computed by PubChem (NCBI)