CAS 675602-89-8 is the registry number for 2-Amino-3,6-difluoro-4-(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
3,6-difluoro-4-(trifluoromethyl)pyridin-2-amine (CAS 675602-89-8) is a chemical compound with the molecular formula C6H3F5N2 and a molecular weight of 198.09 g/mol. IUPAC name: 3,6-difluoro-4-(trifluoromethyl)pyridin-2-amine. InChIKey: GJYDRBORZUFFEB-UHFFFAOYSA-N.
| Molecular formula | C6H3F5N2 |
|---|---|
| Molecular weight | 198.09 g/mol |
| IUPAC name | 3,6-difluoro-4-(trifluoromethyl)pyridin-2-amine |
| InChIKey | GJYDRBORZUFFEB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1F)N)F)C(F)(F)F |
Computed by PubChem (NCBI)