Products 67567-23-1

CAS 67567-23-1 is the registry number for Lupersol 533-M75. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 3,3-bis(2-methylbutan-2-ylperoxy)butanoate (CAS 67567-23-1) is a chemical compound with the molecular formula C16H32O6 and a molecular weight of 320.42 g/mol. IUPAC name: ethyl 3,3-bis(2-methylbutan-2-ylperoxy)butanoate. InChIKey: NICWAKGKDIAMOD-UHFFFAOYSA-N.

Identity
Molecular formulaC16H32O6
Molecular weight320.42 g/mol
IUPAC nameethyl 3,3-bis(2-methylbutan-2-ylperoxy)butanoate
InChIKeyNICWAKGKDIAMOD-UHFFFAOYSA-N
SMILESCCC(C)(C)OOC(C)(CC(=O)OCC)OOC(C)(C)CC

Computed by PubChem (NCBI)