Products 67567-44-6
CAS 67567-44-6 is the registry number for 5-Chloro-2-nitrobenzylamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
(5-chloro-2-nitrophenyl)methanamine (CAS 67567-44-6) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: (5-chloro-2-nitrophenyl)methanamine. InChIKey: LTXOSXDGPYTXPL-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | (5-chloro-2-nitrophenyl)methanamine |
| InChIKey | LTXOSXDGPYTXPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CN)[N+](=O)[O-] |
Computed by PubChem (NCBI)