CAS 67579-18-4 appears in our catalog under these names: 4-Fluoro U-47931E, 4–fluoro U–47931E. Offered by: TRC, GLPBio. Available pack sizes: 500mg, 1mg, 5mg.
N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-4-fluorobenzamide (CAS 67579-18-4) is a chemical compound with the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. IUPAC name: N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-4-fluorobenzamide. InChIKey: WEOTVYIQUFADHZ-ZIAGYGMSSA-N.
| Molecular formula | C15H21FN2O |
|---|---|
| Molecular weight | 264.34 g/mol |
| IUPAC name | N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-4-fluorobenzamide |
| InChIKey | WEOTVYIQUFADHZ-ZIAGYGMSSA-N |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1NC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)