CAS 67580-86-3 appears in our catalog under these names: H-Thr(bzl)-obzl hydrochloride, 98%, H-Thr(Bzl)-Obzl.HCl, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
Benzyl (2S,3R)-2-amino-3-phenylmethoxybutanoate;hydrochloride (CAS 67580-86-3) is a chemical compound with the molecular formula C18H22ClNO3 and a molecular weight of 335.8 g/mol. IUPAC name: benzyl (2S,3R)-2-amino-3-phenylmethoxybutanoate;hydrochloride. InChIKey: ORVAXKPZMYPUKE-CVLQQERVSA-N.
| Molecular formula | C18H22ClNO3 |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | benzyl (2S,3R)-2-amino-3-phenylmethoxybutanoate;hydrochloride |
| InChIKey | ORVAXKPZMYPUKE-CVLQQERVSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OCC1=CC=CC=C1)N)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)