CAS 676-47-1 appears in our catalog under these names: Butanedioic acid,potassium salt (1:2), 97%, 97%, Dipotassium succinate trihydrate, 98%, Dipotassium succinate trihydrate, Potassium succinate 98%, Potassium succinate, 98%. Offered by: Chemat, Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100g, 25g, 10g.
Dipotassium;butanedioate (CAS 676-47-1) is a chemical compound with the molecular formula C4H4K2O4 and a molecular weight of 194.27 g/mol. IUPAC name: dipotassium;butanedioate. InChIKey: CVOQYKPWIVSMDC-UHFFFAOYSA-L.
| Molecular formula | C4H4K2O4 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | dipotassium;butanedioate |
| InChIKey | CVOQYKPWIVSMDC-UHFFFAOYSA-L |
| SMILES | C(CC(=O)[O-])C(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)