CAS 6761-87-1 is the registry number for 1-(5,6-Dimethyl-1H-benzo[d]imidazol-2-yl)ethanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5,6-dimethyl-1H-benzimidazol-2-yl)ethanol (CAS 6761-87-1) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 1-(5,6-dimethyl-1H-benzimidazol-2-yl)ethanol. InChIKey: DKRMFBMUPMZVSA-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 1-(5,6-dimethyl-1H-benzimidazol-2-yl)ethanol |
| InChIKey | DKRMFBMUPMZVSA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N=C(N2)C(C)O |
Computed by PubChem (NCBI)