CAS 676133-39-4 is the registry number for 6-Iodochroman-4-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-iodo-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 676133-39-4) is a chemical compound with the molecular formula C9H11ClINO and a molecular weight of 311.55 g/mol. IUPAC name: 6-iodo-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: VCMCRJWLMHGHMU-UHFFFAOYSA-N.
| Molecular formula | C9H11ClINO |
|---|---|
| Molecular weight | 311.55 g/mol |
| IUPAC name | 6-iodo-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | VCMCRJWLMHGHMU-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=C(C=C2)I.Cl |
Computed by PubChem (NCBI)