Products 676348-29-1
CAS 676348-29-1 is the registry number for 6-(2-Methylbutan-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (CAS 676348-29-1) is a chemical compound with the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. IUPAC name: 6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine. InChIKey: UWAQUYBLJCIERB-UHFFFAOYSA-N.
| Molecular formula | C12H20N2S |
|---|---|
| Molecular weight | 224.37 g/mol |
| IUPAC name | 6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| InChIKey | UWAQUYBLJCIERB-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1CCC2=C(C1)SC(=N2)N |
Computed by PubChem (NCBI)