CAS 676440-40-7 is the registry number for 5-Bromo-N-(2,5-dimethylphenyl)thiophene-2-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(2,5-dimethylphenyl)thiophene-2-sulfonamide (CAS 676440-40-7) is a chemical compound with the molecular formula C12H12BrNO2S2 and a molecular weight of 346.3 g/mol. IUPAC name: 5-bromo-N-(2,5-dimethylphenyl)thiophene-2-sulfonamide. InChIKey: SGTRLBBNTAISRW-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2S2 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 5-bromo-N-(2,5-dimethylphenyl)thiophene-2-sulfonamide |
| InChIKey | SGTRLBBNTAISRW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NS(=O)(=O)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)