CAS 676515-34-7 appears in our catalog under these names: 6-Bromo-2,3-dihydro-1,8-naphthyridin-4(1H)-one, 95%, 95%, 6-Bromo-2,3-dihydro-1,8-naphthyridin-4(1H)-one, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g.
6-bromo-2,3-dihydro-1H-1,8-naphthyridin-4-one (CAS 676515-34-7) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1H-1,8-naphthyridin-4-one. InChIKey: ZVCUHOJEMHNZIO-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1H-1,8-naphthyridin-4-one |
| InChIKey | ZVCUHOJEMHNZIO-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C1=O)C=C(C=N2)Br |
Computed by PubChem (NCBI)