CAS 676542-82-8 appears in our catalog under these names: Poly{(2,5-bis(2-(N,N-diethylamino)ethoxy)-1,4-phenylene)-alt-1,4-phenylene}, 4,7-Di(9H-carbazol-9-yl)-1,10-phenanthroline, 98%, 98%, 4,7-Di-9H-carbazol-9-yl-1,10-phenanthroline, 95%. Offered by: Lumtec, Chemat, Fluorochem. Available pack sizes: On request, 100mg, 250mg, 1g.
4,7-di(carbazol-9-yl)-1,10-phenanthroline (CAS 676542-82-8) is a chemical compound with the molecular formula C36H22N4 and a molecular weight of 510.6 g/mol. IUPAC name: 4,7-di(carbazol-9-yl)-1,10-phenanthroline. InChIKey: ZEPNEZBNLFFDDA-UHFFFAOYSA-N.
| Molecular formula | C36H22N4 |
|---|---|
| Molecular weight | 510.6 g/mol |
| IUPAC name | 4,7-di(carbazol-9-yl)-1,10-phenanthroline |
| InChIKey | ZEPNEZBNLFFDDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=C5C=CC6=C(C=CN=C6C5=NC=C4)N7C8=CC=CC=C8C9=CC=CC=C97 |
Computed by PubChem (NCBI)