CAS 676560-15-9 appears in our catalog under these names: Ethyl 4-((tert-butyldimethylsilyl)oxy)cyclohexanecarboxylate, 95%, Ethyl 4-((tert-butyldimethylsilyl)oxy)cyclohexanecarboxylate 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 100mg, 250mg, 10g, 1g, 5g.
Ethyl 4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxylate (CAS 676560-15-9) is a chemical compound with the molecular formula C15H30O3Si and a molecular weight of 286.48 g/mol. IUPAC name: ethyl 4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxylate. InChIKey: VFEJEBVELPDVHI-UHFFFAOYSA-N.
| Molecular formula | C15H30O3Si |
|---|---|
| Molecular weight | 286.48 g/mol |
| IUPAC name | ethyl 4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxylate |
| InChIKey | VFEJEBVELPDVHI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC(CC1)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)