CAS 677-69-0 appears in our catalog under these names: 2-Iodoheptafluoropropane, Heptafluoro–2–iodopropane, Heptafluoroisopropyl Iodide, >95.0%(GC), PERFLUOROISOPROPYL IODIDE, 98%, Heptafluoroisopropyl Iodide, 97%, 97%. Offered by: TRC, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 1g, 25g, 100g, 500g, 5g, 250g, 5kg.
1,1,1,2,3,3,3-heptafluoro-2-iodopropane (CAS 677-69-0) is a chemical compound with the molecular formula C3F7I and a molecular weight of 295.93 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptafluoro-2-iodopropane. InChIKey: BBZVTTKMXRPMHZ-UHFFFAOYSA-N.
| Molecular formula | C3F7I |
|---|---|
| Molecular weight | 295.93 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptafluoro-2-iodopropane |
| InChIKey | BBZVTTKMXRPMHZ-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)F)(F)I |
Computed by PubChem (NCBI)