CAS 677277-39-3 is the registry number for 3-Amino-5-(tert-butyl)thiophene-2-carbonitrile, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-amino-5-tert-butylthiophene-2-carbonitrile (CAS 677277-39-3) is a chemical compound with the molecular formula C9H12N2S and a molecular weight of 180.27 g/mol. IUPAC name: 3-amino-5-tert-butylthiophene-2-carbonitrile. InChIKey: LXOOZZBIGDJRKD-UHFFFAOYSA-N.
| Molecular formula | C9H12N2S |
|---|---|
| Molecular weight | 180.27 g/mol |
| IUPAC name | 3-amino-5-tert-butylthiophene-2-carbonitrile |
| InChIKey | LXOOZZBIGDJRKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(S1)C#N)N |
Computed by PubChem (NCBI)