CAS 677327-02-5 is the registry number for 4-(3-(4-Bromophenyl)ureido)-2-methylbenzene-1-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-[(4-bromophenyl)carbamoylamino]-2-methylbenzenesulfonyl chloride (CAS 677327-02-5) is a chemical compound with the molecular formula C14H12BrClN2O3S and a molecular weight of 403.7 g/mol. IUPAC name: 4-[(4-bromophenyl)carbamoylamino]-2-methylbenzenesulfonyl chloride. InChIKey: DXIRLUXWXUODDY-UHFFFAOYSA-N.
| Molecular formula | C14H12BrClN2O3S |
|---|---|
| Molecular weight | 403.7 g/mol |
| IUPAC name | 4-[(4-bromophenyl)carbamoylamino]-2-methylbenzenesulfonyl chloride |
| InChIKey | DXIRLUXWXUODDY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)NC2=CC=C(C=C2)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)