CAS 67739-71-3 appears in our catalog under these names: 3-Hydroxyflunitrazepam, 3-Hydroxy Flunitrazepam, 3–hydroxy Flunitrazepam, 3-Hydroxyflunitrazepam, 1mg/ml in Acetonitrile. Offered by: Lipomed, Biosynth, MedChemExpress, TRC, GLPBio. Available pack sizes: 50mg, 100mg, 10mg, 5mg, 25mg, 5 mg, 1 mg, 1mg.
5-(2-fluorophenyl)-3-hydroxy-1-methyl-7-nitro-3H-1,4-benzodiazepin-2-one (CAS 67739-71-3) is a chemical compound with the molecular formula C16H12FN3O4 and a molecular weight of 329.28 g/mol. IUPAC name: 5-(2-fluorophenyl)-3-hydroxy-1-methyl-7-nitro-3H-1,4-benzodiazepin-2-one. InChIKey: KJTUBZKMFRILQD-UHFFFAOYSA-N.
| Molecular formula | C16H12FN3O4 |
|---|---|
| Molecular weight | 329.28 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-3-hydroxy-1-methyl-7-nitro-3H-1,4-benzodiazepin-2-one |
| InChIKey | KJTUBZKMFRILQD-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)[N+](=O)[O-])C(=NC(C1=O)O)C3=CC=CC=C3F |
Computed by PubChem (NCBI)