CAS 67761-53-9 is the registry number for 2-Hydroxy-2-methyl-3-oxo-butanoic acid sodium salt. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
Sodium 2-hydroxy-2-methyl-3-oxobutanoate (CAS 67761-53-9) is a chemical compound with the molecular formula C5H7NaO4 and a molecular weight of 154.10 g/mol. IUPAC name: sodium 2-hydroxy-2-methyl-3-oxobutanoate. InChIKey: LFBMSCPOBZUCJU-UHFFFAOYSA-M.
| Molecular formula | C5H7NaO4 |
|---|---|
| Molecular weight | 154.10 g/mol |
| IUPAC name | sodium 2-hydroxy-2-methyl-3-oxobutanoate |
| InChIKey | LFBMSCPOBZUCJU-UHFFFAOYSA-M |
| SMILES | CC(=O)C(C)(C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)