Products 67786-14-5
CAS 67786-14-5 is the registry number for Acid Red 337. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 6-amino-4-hydroxy-5-[[2-(trifluoromethyl)phenyl]diazenyl]naphthalene-2-sulfonate (CAS 67786-14-5) is a chemical compound with the molecular formula C17H11F3N3NaO4S and a molecular weight of 433.3 g/mol. IUPAC name: sodium 6-amino-4-hydroxy-5-[[2-(trifluoromethyl)phenyl]diazenyl]naphthalene-2-sulfonate. InChIKey: ZJKLNUHASXGERK-UHFFFAOYSA-M.
| Molecular formula | C17H11F3N3NaO4S |
|---|---|
| Molecular weight | 433.3 g/mol |
| IUPAC name | sodium 6-amino-4-hydroxy-5-[[2-(trifluoromethyl)phenyl]diazenyl]naphthalene-2-sulfonate |
| InChIKey | ZJKLNUHASXGERK-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)N=NC2=C(C=CC3=CC(=CC(=C32)O)S(=O)(=O)[O-])N.[Na+] |
Computed by PubChem (NCBI)