CAS 678-13-7 is the registry number for 1,2-Dichloro-4-iodoperfluorobutane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,2-dichloro-1,1,2,3,3,4,4-heptafluoro-4-iodobutane (CAS 678-13-7) is a chemical compound with the molecular formula C4Cl2F7I and a molecular weight of 378.84 g/mol. IUPAC name: 1,2-dichloro-1,1,2,3,3,4,4-heptafluoro-4-iodobutane. InChIKey: YRAAQTPTEGTGOK-UHFFFAOYSA-N.
| Molecular formula | C4Cl2F7I |
|---|---|
| Molecular weight | 378.84 g/mol |
| IUPAC name | 1,2-dichloro-1,1,2,3,3,4,4-heptafluoro-4-iodobutane |
| InChIKey | YRAAQTPTEGTGOK-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)Cl)(F)Cl)(C(F)(F)I)(F)F |
Computed by PubChem (NCBI)