CAS 678-18-2 is the registry number for 1H,1H,1H-Nonafluoro-2-hexanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,3,4,4,5,5,6,6,6-nonafluorohexan-2-one (CAS 678-18-2) is a chemical compound with the molecular formula C6H3F9O and a molecular weight of 262.07 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,6-nonafluorohexan-2-one. InChIKey: LPPFRPMJUNOKRS-UHFFFAOYSA-N.
| Molecular formula | C6H3F9O |
|---|---|
| Molecular weight | 262.07 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,6-nonafluorohexan-2-one |
| InChIKey | LPPFRPMJUNOKRS-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)