CAS 678-32-0 is the registry number for 1,2-Dibromoperfluoroheptane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,2-dibromo-1,1,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptane (CAS 678-32-0) is a chemical compound with the molecular formula C7Br2F14 and a molecular weight of 509.86 g/mol. IUPAC name: 1,2-dibromo-1,1,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptane. InChIKey: HSLSYHFNCGWUKN-UHFFFAOYSA-N.
| Molecular formula | C7Br2F14 |
|---|---|
| Molecular weight | 509.86 g/mol |
| IUPAC name | 1,2-dibromo-1,1,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptane |
| InChIKey | HSLSYHFNCGWUKN-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)Br)(F)Br)(F)F)(F)F |
Computed by PubChem (NCBI)