CAS 678-45-5 appears in our catalog under these names: Dodecafluorosuberic acid, 95%, 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluorooctanedioic acid, 98%, Dodecafluorosuberic acid, Dodecafluorosuberic Acid, >97.0%(T), Dodecafluorosuberic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioic acid (CAS 678-45-5) is a chemical compound with the molecular formula C8H2F12O4 and a molecular weight of 390.08 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioic acid. InChIKey: QYCPVKMFWNBDPV-UHFFFAOYSA-N.
| Molecular formula | C8H2F12O4 |
|---|---|
| Molecular weight | 390.08 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioic acid |
| InChIKey | QYCPVKMFWNBDPV-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(=O)O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)