Products 67809-84-1
CAS 67809-84-1 is the registry number for 3,3'–Disulfanediylbis(2–acetamido–3–methylbutanoic acid). Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-acetamido-3-[(1-acetamido-1-carboxy-2-methylpropan-2-yl)disulfanyl]-3-methylbutanoic acid (CAS 67809-84-1) is a chemical compound with the molecular formula C14H24N2O6S2 and a molecular weight of 380.5 g/mol. IUPAC name: 2-acetamido-3-[(1-acetamido-1-carboxy-2-methylpropan-2-yl)disulfanyl]-3-methylbutanoic acid. InChIKey: TYARMXWNXXYBMN-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O6S2 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | 2-acetamido-3-[(1-acetamido-1-carboxy-2-methylpropan-2-yl)disulfanyl]-3-methylbutanoic acid |
| InChIKey | TYARMXWNXXYBMN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C(=O)O)C(C)(C)SSC(C)(C)C(C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)