Products 678150-56-6
CAS 678150-56-6 appears in our catalog under these names: M-Peg7-4-nitrophenyl carbonate, 95%, m-PEG7-4-nitrophenyl carbonate, 98%, m-PEG7-4-nitrophenyl carbonate, m–PEG7–4–nitrophenyl carbonate, m-PEG7-4-nitrophenyl carbonate, 98%, 98%. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl (4-nitrophenyl) carbonate (CAS 678150-56-6) is a chemical compound with the molecular formula C20H31NO11 and a molecular weight of 461.5 g/mol. IUPAC name: 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl (4-nitrophenyl) carbonate. InChIKey: LBVAFMHNSCFAMU-UHFFFAOYSA-N.
| Molecular formula | C20H31NO11 |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl (4-nitrophenyl) carbonate |
| InChIKey | LBVAFMHNSCFAMU-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)