Products 67827-60-5
CAS 67827-60-5 is the registry number for Acid blue 260. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 1-amino-4-[3-(benzamidomethyl)-2,4,6-trimethylanilino]-9,10-dioxoanthracene-2-sulfonate (CAS 67827-60-5) is a chemical compound with the molecular formula C31H26N3NaO6S and a molecular weight of 591.6 g/mol. IUPAC name: sodium 1-amino-4-[3-(benzamidomethyl)-2,4,6-trimethylanilino]-9,10-dioxoanthracene-2-sulfonate. InChIKey: OFHDOLUPOLKDSG-UHFFFAOYSA-M.
| Molecular formula | C31H26N3NaO6S |
|---|---|
| Molecular weight | 591.6 g/mol |
| IUPAC name | sodium 1-amino-4-[3-(benzamidomethyl)-2,4,6-trimethylanilino]-9,10-dioxoanthracene-2-sulfonate |
| InChIKey | OFHDOLUPOLKDSG-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1CNC(=O)C2=CC=CC=C2)C)NC3=CC(=C(C4=C3C(=O)C5=CC=CC=C5C4=O)N)S(=O)(=O)[O-])C.[Na+] |
Computed by PubChem (NCBI)
Synonyms:
Acid blue 260, orb2567110