CAS 67836-16-2 is the registry number for N-(3H-2,3,5-triazolyl)-2-(2,4-dichlorophenoxy)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-(2,4-dichlorophenoxy)-N-(1H-1,2,4-triazol-5-yl)acetamide (CAS 67836-16-2) is a chemical compound with the molecular formula C10H8Cl2N4O2 and a molecular weight of 287.10 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)-N-(1H-1,2,4-triazol-5-yl)acetamide. InChIKey: AWGQWXZTLQZPBE-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N4O2 |
|---|---|
| Molecular weight | 287.10 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)-N-(1H-1,2,4-triazol-5-yl)acetamide |
| InChIKey | AWGQWXZTLQZPBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)NC2=NC=NN2 |
Computed by PubChem (NCBI)