Products 67873-35-2
CAS 67873-35-2 is the registry number for Ethyl 2-(7-amino-1,4-dihydro-5-hydroxy-1-methyl-4-oxopyrimido[4,5-c]pyridazin-3-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
Ethyl 2-(7-amino-1-methyl-4,5-dioxo-6H-pyrimido[4,5-c]pyridazin-3-yl)acetate (CAS 67873-35-2) is a chemical compound with the molecular formula C11H13N5O4 and a molecular weight of 279.25 g/mol. IUPAC name: ethyl 2-(7-amino-1-methyl-4,5-dioxo-6H-pyrimido[4,5-c]pyridazin-3-yl)acetate. InChIKey: ARRGJCSOUZZOJA-UHFFFAOYSA-N.
| Molecular formula | C11H13N5O4 |
|---|---|
| Molecular weight | 279.25 g/mol |
| IUPAC name | ethyl 2-(7-amino-1-methyl-4,5-dioxo-6H-pyrimido[4,5-c]pyridazin-3-yl)acetate |
| InChIKey | ARRGJCSOUZZOJA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NN(C2=C(C1=O)C(=O)NC(=N2)N)C |
Computed by PubChem (NCBI)