Products 115423-04-6

CAS 115423-04-6 is the registry number for 3,8-Diethyl 4-aminopyrazolo(3,2-c)(1,2,4)triazine-3,8-dicarboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Diethyl 4-aminopyrazolo[5,1-c][1,2,4]triazine-3,8-dicarboxylate (CAS 115423-04-6) is a chemical compound with the molecular formula C11H13N5O4 and a molecular weight of 279.25 g/mol. IUPAC name: diethyl 4-aminopyrazolo[5,1-c][1,2,4]triazine-3,8-dicarboxylate. InChIKey: ZTANXDMBOGSQQH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13N5O4
Molecular weight279.25 g/mol
IUPAC namediethyl 4-aminopyrazolo[5,1-c][1,2,4]triazine-3,8-dicarboxylate
InChIKeyZTANXDMBOGSQQH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C2N=NC(=C(N2N=C1)N)C(=O)OCC

Computed by PubChem (NCBI)