CAS 67881-98-5 appears in our catalog under these names: 2-Methacryloyloxyethyl phosphorylcholine 98%, 2-(Methacryloyloxy)ethyl 2-(trimethylammonio)ethyl phosphate, 96%, 2–(Methacryloyloxy)ethyl2–(trimethylammonio)ethyl phosphate, 2-(Methacryloyloxy)ethyl 2-(Trimethylammonio)ethyl Phosphate, >96.0%(T), 2-Methacryloyloxyethyl phosphorylcholine, 96%. Offered by: Ambeed, Combi-blocks, GLPBio, TCI, Thermo Scientific (Acros). Available pack sizes: 1g, 5g, 25g, 100g, 5 g, 250 mg, 1 g, 500g.
2-(2-methylprop-2-enoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate (CAS 67881-98-5) is a chemical compound with the molecular formula C11H22NO6P and a molecular weight of 295.27 g/mol. IUPAC name: 2-(2-methylprop-2-enoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate. InChIKey: ZSZRUEAFVQITHH-UHFFFAOYSA-N.
| Molecular formula | C11H22NO6P |
|---|---|
| Molecular weight | 295.27 g/mol |
| IUPAC name | 2-(2-methylprop-2-enoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate |
| InChIKey | ZSZRUEAFVQITHH-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOP(=O)([O-])OCC[N+](C)(C)C |
Computed by PubChem (NCBI)